[C]Mom said, "Wai[E]"Wait for the moment!"
Gone [Am7]home, went to [Gm7]bed
While the [F]other ki[Am7]kids, they're still [F]outside [G]
I don't [C]feel time when [E]I sleep
So I s[Am7]snuggle up with my [Gm7]sheet
And w[F Am7]wait, for a bright[F]brighter day [G]
I'll play [C]football to[E]tomorrow
With [Am7]only my [Gm7]best friends
People I [F]like, but I [Am7]don't love, [F]are not al[G]allowed
I wonder if [C]Sharo[E]Sharon will see me
But I'll pl[Gm7]play cool
'Cause c[F]ool[Am7] is w[F]hat you have to d[G]o
It's [C]hard to make a [E]point
[Am7]When you're living so [Gm7]loud [F] [Am7]
[F]Turn it do[G]down
Trying to [C]get my friend exc[E]excited
Ab[Am7]About not being [Gm7]invited
I [F]say:[Am7] "That's an oppor[F]tunit[G]y!"
[C E]Butt dialed I smile
Listen di[Am7]dialed I smile
[Gm7]It w[F]was so [Am7]nice [F]to get a [G]call
[C]Sharon, [E]I'm good at [Am7]stuff
And you're [Gm7]into stuff -[F]-woo[Am7]wooh-
Let's make[F]make product[G]products
-ohh o[C]ohh- I'm a [E]product guy [Am7]
You're a [Gm7]produce girl [F]
I sai[Am7]said money money money
[F]money money will be [G]spent
I'm [C]attuned[E]attuned to the [Am7]grooves [Gm7]
That [F]turn you off[Am7]off
[F]Bass man,[G]man, break it down!
[C E]Butt dialed I smile
Listen di[Am7]dialed I smile
[Gm7]It was so[F]so n[Am7]nice [F]to get a [G]call
Ohh, [C]Sharon, [E]Ooh ohh I'm [Am7]good at stuff
And you're [Gm7]into stuff -[F]-woo[Am7]wooh-
Let's make[F]make product[G]products
-Y[C]eah- I'm a[E] product kind[Am7] of guy
You're a [Gm7]produce kinda[F]kinda girl
I sai[Am7]said money money money
[F]money money will be [G]spent
I'm [C]attuned[E]attuned to the [Am7]grooves [Gm7]
That [F]turn you off[Am7]off
[F]Oh-oh-oh-[G]Oh-oh-oh-oh-oh
[C]Whoooooooooooo